C25H19N7O8 — CID 6834257
N-[[5-imino-2-(2-methoxyphenyl)-4-[(3-nitrobenzoyl)hydrazinylidene]oxolan-3-ylidene]amino]-3-nitrobenzamide (PubChem CID 6834257) has the molecular formula C25H19N7O8 and a molecular weight of 545.47 g/mol. Its IUPAC name is N-[[5-imino-2-(2-methoxyphenyl)-4-[(3-nitrobenzoyl)hydrazinylidene]oxolan-3-ylidene]amino]-3-nitrobenzamide.
| Compound Name | N-[[5-imino-2-(2-methoxyphenyl)-4-[(3-nitrobenzoyl)hydrazinylidene]oxolan-3-ylidene]amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 6834257 |
| Molecular Formula | C25H19N7O8 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | N-[[5-imino-2-(2-methoxyphenyl)-4-[(3-nitrobenzoyl)hydrazinylidene]oxolan-3-ylidene]amino]-3-nitrobenzamide |
| SMILES | [H]/N=C1\OC(c2ccccc2OC)C(=NNC(=O)c2cccc([N+](=O)[O-])c2)C1=NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H19N7O8/c1-39-19-11-3-2-10-18(19)22-20(27-29-24(33)14-6-4-8-16(12-14)31(35)36)21(23(26)40-22)28-30-25(34)15-7-5-9-17(13-15)32(37)38/h2-13,22,26H,1H3,(H,29,33)(H,30,34)/b26-23-,27-20?,28-21? |
| InChIKey | QNENGKGCIABDFE-MLQBBHOFSA-N |
| XLogP | 3.13 |
| TPSA | 211.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|