C22H14N10O11 — CID 6418398
N-[(E)-[(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-5-imino-2-(3-nitrophenyl)oxolan-3-ylidene]amino]-2,4-dinitroaniline (PubChem CID 6418398) has the molecular formula C22H14N10O11 and a molecular weight of 594.41 g/mol. Its IUPAC name is N-[(E)-[(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-5-imino-2-(3-nitrophenyl)oxolan-3-ylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-5-imino-2-(3-nitrophenyl)oxolan-3-ylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 6418398 |
| Molecular Formula | C22H14N10O11 |
| Molecular Weight | 594.41 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | N-[(E)-[(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-5-imino-2-(3-nitrophenyl)oxolan-3-ylidene]amino]-2,4-dinitroaniline |
| SMILES | [H]/N=C1\OC(c2cccc([N+](=O)[O-])c2)C(=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])/C1=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H14N10O11/c23-22-20(27-25-16-7-5-14(30(37)38)10-18(16)32(41)42)19(21(43-22)11-2-1-3-12(8-11)28(33)34)26-24-15-6-4-13(29(35)36)9-17(15)31(39)40/h1-10,21,23-25H/b23-22-,26-19+,27-20- |
| InChIKey | ANXKZGSXJFQQHS-ZSGDUNINSA-N |
| XLogP | 4.21 |
| TPSA | 297.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|