C22H16N4O8 — CID 136619284
3-(1,3-benzodioxol-5-yl)-4-[(2,4-dinitrophenyl)hydrazinylidene]-2,3-dihydrochromen-7-ol (PubChem CID 136619284) has the molecular formula C22H16N4O8 and a molecular weight of 464.39 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-4-[(2,4-dinitrophenyl)hydrazinylidene]-2,3-dihydrochromen-7-ol.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-4-[(2,4-dinitrophenyl)hydrazinylidene]-2,3-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 136619284 |
| Molecular Formula | C22H16N4O8 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-4-[(2,4-dinitrophenyl)hydrazinylidene]-2,3-dihydrochromen-7-ol |
| SMILES | O=[N+]([O-])c1ccc(NN=C2c3ccc(O)cc3OCC2c2ccc3c(c2)OCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H16N4O8/c27-14-3-4-15-20(9-14)32-10-16(12-1-6-19-21(7-12)34-11-33-19)22(15)24-23-17-5-2-13(25(28)29)8-18(17)26(30)31/h1-9,16,23,27H,10-11H2 |
| InChIKey | VGYGNQFGFJIGRA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 158.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|