C20H24N7O3+3 — CID 6966529
N-[[(4-nitrophenyl)-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yl)methylidene]amino]pyridine-4-carboxamide (PubChem CID 6966529) has the molecular formula C20H24N7O3+3 and a molecular weight of 410.46 g/mol. Its IUPAC name is N-[[(4-nitrophenyl)-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yl)methylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[[(4-nitrophenyl)-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yl)methylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 6966529 |
| Molecular Formula | C20H24N7O3+3 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-[[(4-nitrophenyl)-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yl)methylidene]amino]pyridine-4-carboxamide |
| SMILES | O=C(NN=C(c1ccc([N+](=O)[O-])cc1)C12C[NH+]3C[NH+](C[NH+](C3)C1)C2)c1ccncc1 |
| InChI | InChI=1S/C20H21N7O3/c28-19(16-5-7-21-8-6-16)23-22-18(15-1-3-17(4-2-15)27(29)30)20-9-24-12-25(10-20)14-26(11-20)13-24/h1-8H,9-14H2,(H,23,28)/p+3 |
| InChIKey | OKJYINVFYVUQOH-UHFFFAOYSA-Q |
| XLogP | -3.32 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|