About 4-pyrazin-2-yltriazine
4-pyrazin-2-yltriazine (PubChem CID 69484540) has the molecular formula C7H5N5
and a molecular weight of 159.15 g/mol. Its IUPAC name is 4-pyrazin-2-yltriazine.
Molecular Properties
| Compound Name | 4-pyrazin-2-yltriazine |
| PubChem CID | 69484540 |
| Molecular Formula | C7H5N5 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 4-pyrazin-2-yltriazine |
| SMILES | c1cnc(-c2ccnnn2)cn1 |
| InChI | InChI=1S/C7H5N5/c1-2-10-12-11-6(1)7-5-8-3-4-9-7/h1-5H |
| InChIKey | JBAXTNMSCUJEDZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-pyrazin-2-yltriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrazin-2-yltriazine?
The IUPAC name of 4-pyrazin-2-yltriazine (CID 69484540) is 4-pyrazin-2-yltriazine.
What is the SMILES notation for 4-pyrazin-2-yltriazine?
The canonical SMILES for 4-pyrazin-2-yltriazine is c1cnc(-c2ccnnn2)cn1.
What is the InChIKey of 4-pyrazin-2-yltriazine?
The InChIKey is JBAXTNMSCUJEDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N5/c1-2-10-12-11-6(1)7-5-8-3-4-9-7/h1-5H.
What are the key properties of 4-pyrazin-2-yltriazine?
4-pyrazin-2-yltriazine has a molecular weight of 159.15 g/mol, XLogP of 0.33, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrazin-2-yltriazine is sourced from PubChem (CID 69484540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).