C11H15F2P — CID 69485778
benzyl(2,4-difluorobutyl)phosphane (PubChem CID 69485778) has the molecular formula C11H15F2P and a molecular weight of 216.21 g/mol. Its IUPAC name is benzyl(2,4-difluorobutyl)phosphane.
| Compound Name | benzyl(2,4-difluorobutyl)phosphane |
|---|---|
| PubChem CID | 69485778 |
| Molecular Formula | C11H15F2P |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | benzyl(2,4-difluorobutyl)phosphane |
| SMILES | FCCC(F)CPCc1ccccc1 |
| InChI | InChI=1S/C11H15F2P/c12-7-6-11(13)9-14-8-10-4-2-1-3-5-10/h1-5,11,14H,6-9H2 |
| InChIKey | ZDYDCPWNZFPZBQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|