About dibenzylphosphane;dichloropalladium;iron
dibenzylphosphane;dichloropalladium;iron (PubChem CID 175421124) has the molecular formula C14H15Cl2FePPd
and a molecular weight of 447.42 g/mol. Its IUPAC name is dibenzylphosphane;dichloropalladium;iron.
Molecular Properties
| Compound Name | dibenzylphosphane;dichloropalladium;iron |
| PubChem CID | 175421124 |
| Molecular Formula | C14H15Cl2FePPd |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 445.87 |
| IUPAC Name | dibenzylphosphane;dichloropalladium;iron |
| SMILES | Cl[Pd]Cl.[Fe].c1ccc(CPCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15P.2ClH.Fe.Pd/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;;;/h1-10,15H,11-12H2;2*1H;;/q;;;;+2/p-2 |
| InChIKey | XUPUXVXYLFLLFE-UHFFFAOYSA-L |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibenzylphosphane;dichloropalladium;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzylphosphane;dichloropalladium;iron?
The IUPAC name of dibenzylphosphane;dichloropalladium;iron (CID 175421124) is dibenzylphosphane;dichloropalladium;iron.
What is the SMILES notation for dibenzylphosphane;dichloropalladium;iron?
The canonical SMILES for dibenzylphosphane;dichloropalladium;iron is Cl[Pd]Cl.[Fe].c1ccc(CPCc2ccccc2)cc1.
What is the InChIKey of dibenzylphosphane;dichloropalladium;iron?
The InChIKey is XUPUXVXYLFLLFE-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H15P.2ClH.Fe.Pd/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;;;/h1-10,15H,11-12H2;2*1H;;/q;;;;+2/p-2.
What are the key properties of dibenzylphosphane;dichloropalladium;iron?
dibenzylphosphane;dichloropalladium;iron has a molecular weight of 447.42 g/mol, XLogP of 5.44, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzylphosphane;dichloropalladium;iron is sourced from PubChem (CID 175421124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).