C24H23F2NO5 — CID 69488189
2-cyclobutyl-2-[1-[4-(difluoromethoxy)benzoyl]-5-methoxy-2-methylindol-3-yl]acetic acid (PubChem CID 69488189) has the molecular formula C24H23F2NO5 and a molecular weight of 443.45 g/mol. Its IUPAC name is 2-cyclobutyl-2-[1-[4-(difluoromethoxy)benzoyl]-5-methoxy-2-methylindol-3-yl]acetic acid.
| Compound Name | 2-cyclobutyl-2-[1-[4-(difluoromethoxy)benzoyl]-5-methoxy-2-methylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 69488189 |
| Molecular Formula | C24H23F2NO5 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-cyclobutyl-2-[1-[4-(difluoromethoxy)benzoyl]-5-methoxy-2-methylindol-3-yl]acetic acid |
| SMILES | COc1ccc2c(c1)c(C(C(=O)O)C1CCC1)c(C)n2C(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C24H23F2NO5/c1-13-20(21(23(29)30)14-4-3-5-14)18-12-17(31-2)10-11-19(18)27(13)22(28)15-6-8-16(9-7-15)32-24(25)26/h6-12,14,21,24H,3-5H2,1-2H3,(H,29,30) |
| InChIKey | WAJZFXDFFDNECU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |