C20H22NO4- — CID 6949018
2-[[2-[2-[(2S)-butan-2-yl]phenoxy]acetyl]amino]-5-methylbenzoate (PubChem CID 6949018) has the molecular formula C20H22NO4- and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-[[2-[2-[(2S)-butan-2-yl]phenoxy]acetyl]amino]-5-methylbenzoate.
| Compound Name | 2-[[2-[2-[(2S)-butan-2-yl]phenoxy]acetyl]amino]-5-methylbenzoate |
|---|---|
| PubChem CID | 6949018 |
| Molecular Formula | C20H22NO4- |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[[2-[2-[(2S)-butan-2-yl]phenoxy]acetyl]amino]-5-methylbenzoate |
| SMILES | CC[C@H](C)c1ccccc1OCC(=O)Nc1ccc(C)cc1C(=O)[O-] |
| InChI | InChI=1S/C20H23NO4/c1-4-14(3)15-7-5-6-8-18(15)25-12-19(22)21-17-10-9-13(2)11-16(17)20(23)24/h5-11,14H,4,12H2,1-3H3,(H,21,22)(H,23,24)/p-1/t14-/m0/s1 |
| InChIKey | VTNVBDZQFCXGDC-AWEZNQCLSA-M |
| XLogP | 2.89 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |