C30H25FN4O — CID 69490760
N-(2-aminophenyl)-3-[3-[1-[1-(4-fluorophenyl)ethyl]benzimidazol-2-yl]phenyl]prop-2-enamide (PubChem CID 69490760) has the molecular formula C30H25FN4O and a molecular weight of 476.56 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[3-[1-[1-(4-fluorophenyl)ethyl]benzimidazol-2-yl]phenyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[3-[1-[1-(4-fluorophenyl)ethyl]benzimidazol-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 69490760 |
| Molecular Formula | C30H25FN4O |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-(2-aminophenyl)-3-[3-[1-[1-(4-fluorophenyl)ethyl]benzimidazol-2-yl]phenyl]prop-2-enamide |
| SMILES | CC(c1ccc(F)cc1)n1c(-c2cccc(C=CC(=O)Nc3ccccc3N)c2)nc2ccccc21 |
| InChI | InChI=1S/C30H25FN4O/c1-20(22-14-16-24(31)17-15-22)35-28-12-5-4-11-27(28)34-30(35)23-8-6-7-21(19-23)13-18-29(36)33-26-10-3-2-9-25(26)32/h2-20H,32H2,1H3,(H,33,36) |
| InChIKey | GSLZOMPASHOJBY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|