C22H23N3O2 — CID 72786372
3-[3-[2,5-dimethyl-3-(1-phenylethyl)imidazol-4-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 72786372) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 3-[3-[2,5-dimethyl-3-(1-phenylethyl)imidazol-4-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[3-[2,5-dimethyl-3-(1-phenylethyl)imidazol-4-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 72786372 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 3-[3-[2,5-dimethyl-3-(1-phenylethyl)imidazol-4-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1nc(C)n(C(C)c2ccccc2)c1-c1cccc(C=CC(=O)NO)c1 |
| InChI | InChI=1S/C22H23N3O2/c1-15-22(20-11-7-8-18(14-20)12-13-21(26)24-27)25(17(3)23-15)16(2)19-9-5-4-6-10-19/h4-14,16,27H,1-3H3,(H,24,26) |
| InChIKey | HCJNIDDIOVYUQA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|