C14H21ClFNO2 — CID 69491473
tert-butyl 4-(3-aminopropyl)-2-fluorobenzoate;hydrochloride (PubChem CID 69491473) has the molecular formula C14H21ClFNO2 and a molecular weight of 289.78 g/mol. Its IUPAC name is tert-butyl 4-(3-aminopropyl)-2-fluorobenzoate;hydrochloride.
| Compound Name | tert-butyl 4-(3-aminopropyl)-2-fluorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 69491473 |
| Molecular Formula | C14H21ClFNO2 |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | tert-butyl 4-(3-aminopropyl)-2-fluorobenzoate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)c1ccc(CCCN)cc1F.Cl |
| InChI | InChI=1S/C14H20FNO2.ClH/c1-14(2,3)18-13(17)11-7-6-10(5-4-8-16)9-12(11)15;/h6-7,9H,4-5,8,16H2,1-3H3;1H |
| InChIKey | MGNAXBGBNIPWES-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |