C25H18ClF3N2O4 — CID 69493298
2-[3-[6-chloro-4-(2-cyclopropylethynyl)-2-oxo-4-(trifluoromethyl)-3,1-benzoxazin-1-yl]propyl]isoindole-1,3-dione (PubChem CID 69493298) has the molecular formula C25H18ClF3N2O4 and a molecular weight of 502.88 g/mol. Its IUPAC name is 2-[3-[6-chloro-4-(2-cyclopropylethynyl)-2-oxo-4-(trifluoromethyl)-3,1-benzoxazin-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[6-chloro-4-(2-cyclopropylethynyl)-2-oxo-4-(trifluoromethyl)-3,1-benzoxazin-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69493298 |
| Molecular Formula | C25H18ClF3N2O4 |
| Molecular Weight | 502.88 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 2-[3-[6-chloro-4-(2-cyclopropylethynyl)-2-oxo-4-(trifluoromethyl)-3,1-benzoxazin-1-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCN1C(=O)OC(C#CC2CC2)(C(F)(F)F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C25H18ClF3N2O4/c26-16-8-9-20-19(14-16)24(25(27,28)29,11-10-15-6-7-15)35-23(34)30(20)12-3-13-31-21(32)17-4-1-2-5-18(17)22(31)33/h1-2,4-5,8-9,14-15H,3,6-7,12-13H2 |
| InChIKey | QVTVVGHFODIRDH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.88 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|