C13H14F2O2 — CID 69493315
2-[(2,3-difluorophenoxy)methyl]cyclohexan-1-one (PubChem CID 69493315) has the molecular formula C13H14F2O2 and a molecular weight of 240.25 g/mol. Its IUPAC name is 2-[(2,3-difluorophenoxy)methyl]cyclohexan-1-one.
| Compound Name | 2-[(2,3-difluorophenoxy)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 69493315 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-[(2,3-difluorophenoxy)methyl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1COc1cccc(F)c1F |
| InChI | InChI=1S/C13H14F2O2/c14-10-5-3-7-12(13(10)15)17-8-9-4-1-2-6-11(9)16/h3,5,7,9H,1-2,4,6,8H2 |
| InChIKey | JHBRTMXHTHNPJI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |