C18H14N4O5 — CID 69497173
3-[2-amino-8-methoxy-5-(3-nitrophenyl)quinazolin-7-yl]prop-2-enoic acid (PubChem CID 69497173) has the molecular formula C18H14N4O5 and a molecular weight of 366.33 g/mol. Its IUPAC name is 3-[2-amino-8-methoxy-5-(3-nitrophenyl)quinazolin-7-yl]prop-2-enoic acid.
| Compound Name | 3-[2-amino-8-methoxy-5-(3-nitrophenyl)quinazolin-7-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69497173 |
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3-[2-amino-8-methoxy-5-(3-nitrophenyl)quinazolin-7-yl]prop-2-enoic acid |
| SMILES | COc1c(C=CC(=O)O)cc(-c2cccc([N+](=O)[O-])c2)c2cnc(N)nc12 |
| InChI | InChI=1S/C18H14N4O5/c1-27-17-11(5-6-15(23)24)8-13(14-9-20-18(19)21-16(14)17)10-3-2-4-12(7-10)22(25)26/h2-9H,1H3,(H,23,24)(H2,19,20,21) |
| InChIKey | KUTZZJPBQBTBKM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|