C26H25ClN2O3 — CID 69497348
3-[[4-[[4-(4-chlorophenyl)benzoyl]amino]phenyl]methyl]piperidine-1-carboxylic acid (PubChem CID 69497348) has the molecular formula C26H25ClN2O3 and a molecular weight of 448.95 g/mol. Its IUPAC name is 3-[[4-[[4-(4-chlorophenyl)benzoyl]amino]phenyl]methyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[[4-[[4-(4-chlorophenyl)benzoyl]amino]phenyl]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69497348 |
| Molecular Formula | C26H25ClN2O3 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-[[4-[[4-(4-chlorophenyl)benzoyl]amino]phenyl]methyl]piperidine-1-carboxylic acid |
| SMILES | O=C(Nc1ccc(CC2CCCN(C(=O)O)C2)cc1)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H25ClN2O3/c27-23-11-9-21(10-12-23)20-5-7-22(8-6-20)25(30)28-24-13-3-18(4-14-24)16-19-2-1-15-29(17-19)26(31)32/h3-14,19H,1-2,15-17H2,(H,28,30)(H,31,32) |
| InChIKey | QCHOGXIKADYFHW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |