About (4-benzamidooxan-4-yl) acetate
(4-benzamidooxan-4-yl) acetate (PubChem CID 69498261) has the molecular formula C14H17NO4
and a molecular weight of 263.29 g/mol. Its IUPAC name is (4-benzamidooxan-4-yl) acetate.
Molecular Properties
| Compound Name | (4-benzamidooxan-4-yl) acetate |
| PubChem CID | 69498261 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (4-benzamidooxan-4-yl) acetate |
| SMILES | CC(=O)OC1(NC(=O)c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C14H17NO4/c1-11(16)19-14(7-9-18-10-8-14)15-13(17)12-5-3-2-4-6-12/h2-6H,7-10H2,1H3,(H,15,17) |
| InChIKey | HUPXCJDXISYYEI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4-benzamidooxan-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzamidooxan-4-yl) acetate?
The IUPAC name of (4-benzamidooxan-4-yl) acetate (CID 69498261) is (4-benzamidooxan-4-yl) acetate.
What is the SMILES notation for (4-benzamidooxan-4-yl) acetate?
The canonical SMILES for (4-benzamidooxan-4-yl) acetate is CC(=O)OC1(NC(=O)c2ccccc2)CCOCC1.
What is the InChIKey of (4-benzamidooxan-4-yl) acetate?
The InChIKey is HUPXCJDXISYYEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-11(16)19-14(7-9-18-10-8-14)15-13(17)12-5-3-2-4-6-12/h2-6H,7-10H2,1H3,(H,15,17).
What are the key properties of (4-benzamidooxan-4-yl) acetate?
(4-benzamidooxan-4-yl) acetate has a molecular weight of 263.29 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzamidooxan-4-yl) acetate is sourced from PubChem (CID 69498261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).