C16H17NO3 — CID 110466381
N-(4-phenyloxan-4-yl)furan-3-carboxamide (PubChem CID 110466381) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-(4-phenyloxan-4-yl)furan-3-carboxamide.
| Compound Name | N-(4-phenyloxan-4-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 110466381 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-(4-phenyloxan-4-yl)furan-3-carboxamide |
| SMILES | O=C(NC1(c2ccccc2)CCOCC1)c1ccoc1 |
| InChI | InChI=1S/C16H17NO3/c18-15(13-6-9-20-12-13)17-16(7-10-19-11-8-16)14-4-2-1-3-5-14/h1-6,9,12H,7-8,10-11H2,(H,17,18) |
| InChIKey | FHDBVOOXUSWKDW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |