C18H22N2O3 — CID 122568439
2-ethyl-4-methyl-N-(4-phenyloxan-4-yl)-1,3-oxazole-5-carboxamide (PubChem CID 122568439) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-ethyl-4-methyl-N-(4-phenyloxan-4-yl)-1,3-oxazole-5-carboxamide.
| Compound Name | 2-ethyl-4-methyl-N-(4-phenyloxan-4-yl)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 122568439 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-ethyl-4-methyl-N-(4-phenyloxan-4-yl)-1,3-oxazole-5-carboxamide |
| SMILES | CCc1nc(C)c(C(=O)NC2(c3ccccc3)CCOCC2)o1 |
| InChI | InChI=1S/C18H22N2O3/c1-3-15-19-13(2)16(23-15)17(21)20-18(9-11-22-12-10-18)14-7-5-4-6-8-14/h4-8H,3,9-12H2,1-2H3,(H,20,21) |
| InChIKey | DJDGMCGHTOOVPH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |