C24H36O2 — CID 69499084
1-[(8S,9S,10R,13S,14S,17S)-3-ethoxy-2,10,13-trimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 69499084) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is 1-[(8S,9S,10R,13S,14S,17S)-3-ethoxy-2,10,13-trimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8S,9S,10R,13S,14S,17S)-3-ethoxy-2,10,13-trimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 69499084 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 1-[(8S,9S,10R,13S,14S,17S)-3-ethoxy-2,10,13-trimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CCOC1=CC2=CC[C@H]3[C@@H]4CC[C@H](C(C)=O)[C@@]4(C)CC[C@@H]3[C@@]2(C)CC1C |
| InChI | InChI=1S/C24H36O2/c1-6-26-22-13-17-7-8-18-20-10-9-19(16(3)25)23(20,4)12-11-21(18)24(17,5)14-15(22)2/h7,13,15,18-21H,6,8-12,14H2,1-5H3/t15?,18-,19+,20-,21-,23+,24-/m0/s1 |
| InChIKey | JTNVRQZBUCHLNE-WCGNPTKBSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |