C28H27FN2O3 — CID 69499547
4-[2-[3-(4-cyanophenyl)-5-fluorophenyl]ethoxymethyl]-4-phenylpiperidine-1-carboxylic acid (PubChem CID 69499547) has the molecular formula C28H27FN2O3 and a molecular weight of 458.53 g/mol. Its IUPAC name is 4-[2-[3-(4-cyanophenyl)-5-fluorophenyl]ethoxymethyl]-4-phenylpiperidine-1-carboxylic acid.
| Compound Name | 4-[2-[3-(4-cyanophenyl)-5-fluorophenyl]ethoxymethyl]-4-phenylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69499547 |
| Molecular Formula | C28H27FN2O3 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 4-[2-[3-(4-cyanophenyl)-5-fluorophenyl]ethoxymethyl]-4-phenylpiperidine-1-carboxylic acid |
| SMILES | N#Cc1ccc(-c2cc(F)cc(CCOCC3(c4ccccc4)CCN(C(=O)O)CC3)c2)cc1 |
| InChI | InChI=1S/C28H27FN2O3/c29-26-17-22(16-24(18-26)23-8-6-21(19-30)7-9-23)10-15-34-20-28(25-4-2-1-3-5-25)11-13-31(14-12-28)27(32)33/h1-9,16-18H,10-15,20H2,(H,32,33) |
| InChIKey | OALSDCLCMZVBOS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|