C27H28F4N2O — CID 68879357
2-(4-fluorophenyl)-6-[2-[(1-methyl-4-phenylpiperidin-4-yl)methoxy]ethyl]-4-(trifluoromethyl)pyridine (PubChem CID 68879357) has the molecular formula C27H28F4N2O and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-[2-[(1-methyl-4-phenylpiperidin-4-yl)methoxy]ethyl]-4-(trifluoromethyl)pyridine.
| Compound Name | 2-(4-fluorophenyl)-6-[2-[(1-methyl-4-phenylpiperidin-4-yl)methoxy]ethyl]-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 68879357 |
| Molecular Formula | C27H28F4N2O |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-(4-fluorophenyl)-6-[2-[(1-methyl-4-phenylpiperidin-4-yl)methoxy]ethyl]-4-(trifluoromethyl)pyridine |
| SMILES | CN1CCC(COCCc2cc(C(F)(F)F)cc(-c3ccc(F)cc3)n2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H28F4N2O/c1-33-14-12-26(13-15-33,21-5-3-2-4-6-21)19-34-16-11-24-17-22(27(29,30)31)18-25(32-24)20-7-9-23(28)10-8-20/h2-10,17-18H,11-16,19H2,1H3 |
| InChIKey | SBBVPIJHCIVKKX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|