C20H22BrF3N2O — CID 58993531
3-[4-[[3-bromo-5-(trifluoromethyl)phenyl]methoxymethyl]-1-methylpiperidin-4-yl]pyridine (PubChem CID 58993531) has the molecular formula C20H22BrF3N2O and a molecular weight of 443.31 g/mol. Its IUPAC name is 3-[4-[[3-bromo-5-(trifluoromethyl)phenyl]methoxymethyl]-1-methylpiperidin-4-yl]pyridine.
| Compound Name | 3-[4-[[3-bromo-5-(trifluoromethyl)phenyl]methoxymethyl]-1-methylpiperidin-4-yl]pyridine |
|---|---|
| PubChem CID | 58993531 |
| Molecular Formula | C20H22BrF3N2O |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 3-[4-[[3-bromo-5-(trifluoromethyl)phenyl]methoxymethyl]-1-methylpiperidin-4-yl]pyridine |
| SMILES | CN1CCC(COCc2cc(Br)cc(C(F)(F)F)c2)(c2cccnc2)CC1 |
| InChI | InChI=1S/C20H22BrF3N2O/c1-26-7-4-19(5-8-26,16-3-2-6-25-12-16)14-27-13-15-9-17(20(22,23)24)11-18(21)10-15/h2-3,6,9-12H,4-5,7-8,13-14H2,1H3 |
| InChIKey | KXQZBVJBNHLUEN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |