C25H26F6N2O4 — CID 10414699
methyl 3-[[4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidin-1-yl]amino]-3-oxopropanoate (PubChem CID 10414699) has the molecular formula C25H26F6N2O4 and a molecular weight of 532.48 g/mol. Its IUPAC name is methyl 3-[[4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidin-1-yl]amino]-3-oxopropanoate.
| Compound Name | methyl 3-[[4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidin-1-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 10414699 |
| Molecular Formula | C25H26F6N2O4 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | methyl 3-[[4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidin-1-yl]amino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)NN1CCC(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H26F6N2O4/c1-36-22(35)14-21(34)32-33-9-7-23(8-10-33,18-5-3-2-4-6-18)16-37-15-17-11-19(24(26,27)28)13-20(12-17)25(29,30)31/h2-6,11-13H,7-10,14-16H2,1H3,(H,32,34) |
| InChIKey | NPBVCMHYGGUFGY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|