C22H23F6NO — CID 11654898
(4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylazepane (PubChem CID 11654898) has the molecular formula C22H23F6NO and a molecular weight of 431.42 g/mol. Its IUPAC name is (4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylazepane.
| Compound Name | (4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylazepane |
|---|---|
| PubChem CID | 11654898 |
| Molecular Formula | C22H23F6NO |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylazepane |
| SMILES | FC(F)(F)c1cc(COC[C@]2(c3ccccc3)CCCNCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F6NO/c23-21(24,25)18-11-16(12-19(13-18)22(26,27)28)14-30-15-20(7-4-9-29-10-8-20)17-5-2-1-3-6-17/h1-3,5-6,11-13,29H,4,7-10,14-15H2/t20-/m0/s1 |
| InChIKey | QLXHEEVESGWCHN-FQEVSTJZSA-N |
| XLogP | 5.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |