C27H28F3NO2 — CID 24784708
[3-[3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]phenyl]methanol (PubChem CID 24784708) has the molecular formula C27H28F3NO2 and a molecular weight of 455.52 g/mol. Its IUPAC name is [3-[3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]phenyl]methanol.
| Compound Name | [3-[3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 24784708 |
| Molecular Formula | C27H28F3NO2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | [3-[3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]phenyl]methanol |
| SMILES | OCc1cccc(-c2cc(COCC3(c4ccccc4)CCNCC3)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H28F3NO2/c28-27(29,30)25-15-21(14-23(16-25)22-6-4-5-20(13-22)17-32)18-33-19-26(9-11-31-12-10-26)24-7-2-1-3-8-24/h1-8,13-16,31-32H,9-12,17-19H2 |
| InChIKey | QTKUERJXCZUQKS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |