C28H30F3NO2 — CID 58993611
4-[[3-(3-ethoxyphenyl)-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine (PubChem CID 58993611) has the molecular formula C28H30F3NO2 and a molecular weight of 469.55 g/mol. Its IUPAC name is 4-[[3-(3-ethoxyphenyl)-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine.
| Compound Name | 4-[[3-(3-ethoxyphenyl)-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine |
|---|---|
| PubChem CID | 58993611 |
| Molecular Formula | C28H30F3NO2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 4-[[3-(3-ethoxyphenyl)-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine |
| SMILES | CCOc1cccc(-c2cc(COCC3(c4ccccc4)CCNCC3)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C28H30F3NO2/c1-2-34-26-10-6-7-22(18-26)23-15-21(16-25(17-23)28(29,30)31)19-33-20-27(11-13-32-14-12-27)24-8-4-3-5-9-24/h3-10,15-18,32H,2,11-14,19-20H2,1H3 |
| InChIKey | LBUHGZXVLOWKIG-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |