C20H23F3N2O — CID 143563799
3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)aniline (PubChem CID 143563799) has the molecular formula C20H23F3N2O and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)aniline.
| Compound Name | 3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 143563799 |
| Molecular Formula | C20H23F3N2O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)aniline |
| SMILES | Nc1cc(COCC2(c3ccccc3)CCNCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H23F3N2O/c21-20(22,23)17-10-15(11-18(24)12-17)13-26-14-19(6-8-25-9-7-19)16-4-2-1-3-5-16/h1-5,10-12,25H,6-9,13-14,24H2 |
| InChIKey | WABUMWJYTFLIMG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|