C22H28F3N5O — CID 143563762
N,N'-diamino-N-methyl-3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)benzenecarboximidamide (PubChem CID 143563762) has the molecular formula C22H28F3N5O and a molecular weight of 435.49 g/mol. Its IUPAC name is N,N'-diamino-N-methyl-3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N,N'-diamino-N-methyl-3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 143563762 |
| Molecular Formula | C22H28F3N5O |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N,N'-diamino-N-methyl-3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)benzenecarboximidamide |
| SMILES | CN(N)/C(=N\N)c1cc(COCC2(c3ccccc3)CCNCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H28F3N5O/c1-30(27)20(29-26)17-11-16(12-19(13-17)22(23,24)25)14-31-15-21(7-9-28-10-8-21)18-5-3-2-4-6-18/h2-6,11-13,28H,7-10,14-15,26-27H2,1H3/b29-20- |
| InChIKey | BJOOUWHMIVBKOJ-BRPDVVIDSA-N |
| XLogP | 2.97 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|