C66H68F12N2O8 — CID 57307204
bis[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidin-1-yl]-3-(3-ethylphenoxy)propan-2-yl] oxalate (PubChem CID 57307204) has the molecular formula C66H68F12N2O8 and a molecular weight of 1245.25 g/mol. Its IUPAC name is bis[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidin-1-yl]-3-(3-ethylphenoxy)propan-2-yl] oxalate.
| Compound Name | bis[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidin-1-yl]-3-(3-ethylphenoxy)propan-2-yl] oxalate |
|---|---|
| PubChem CID | 57307204 |
| Molecular Formula | C66H68F12N2O8 |
| Molecular Weight | 1245.25 g/mol |
| Exact Mass | 1244.48 |
| IUPAC Name | bis[1-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidin-1-yl]-3-(3-ethylphenoxy)propan-2-yl] oxalate |
| SMILES | CCc1cccc(OCC(CN2CCC(COCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)(c3ccccc3)CC2)OC(=O)C(=O)OC(COc2cccc(CC)c2)CN2CCC(COCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C66H68F12N2O8/c1-3-45-13-11-19-55(33-45)85-41-57(37-79-25-21-61(22-26-79,49-15-7-5-8-16-49)43-83-39-47-29-51(63(67,68)69)35-52(30-47)64(70,71)72)87-59(81)60(82)88-58(42-86-56-20-12-14-46(4-2)34-56)38-80-27-23-62(24-28-80,50-17-9-6-10-18-50)44-84-40-48-31-53(65(73,74)75)36-54(32-48)66(76,77)78/h5-20,29-36,57-58H,3-4,21-28,37-44H2,1-2H3 |
| InChIKey | KHNZYHADIIXUOF-UHFFFAOYSA-N |
| XLogP | 14.67 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1245.25 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|