About (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane
(3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane (PubChem CID 71583096) has the molecular formula C23H25F6NO
and a molecular weight of 445.45 g/mol. Its IUPAC name is (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane.
Molecular Properties
| Compound Name | (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane |
| PubChem CID | 71583096 |
| Molecular Formula | C23H25F6NO |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane |
| SMILES | CN1CCCC[C@](COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)C1 |
| InChI | InChI=1S/C23H25F6NO/c1-30-10-6-5-9-21(15-30,18-7-3-2-4-8-18)16-31-14-17-11-19(22(24,25)26)13-20(12-17)23(27,28)29/h2-4,7-8,11-13H,5-6,9-10,14-16H2,1H3/t21-/m0/s1 |
| InChIKey | FVMGZIMTEZPJGA-NRFANRHFSA-N |
| XLogP | 6.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane?
The IUPAC name of (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane (CID 71583096) is (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane.
What is the SMILES notation for (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane?
The canonical SMILES for (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane is CN1CCCC[C@](COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)C1.
What is the InChIKey of (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane?
The InChIKey is FVMGZIMTEZPJGA-NRFANRHFSA-N. The full InChI is InChI=1S/C23H25F6NO/c1-30-10-6-5-9-21(15-30,18-7-3-2-4-8-18)16-31-14-17-11-19(22(24,25)26)13-20(12-17)23(27,28)29/h2-4,7-8,11-13H,5-6,9-10,14-16H2,1H3/t21-/m0/s1.
What are the key properties of (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane?
(3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane has a molecular weight of 445.45 g/mol, XLogP of 6.29, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-3-phenylazepane is sourced from PubChem (CID 71583096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).