C21H20F6N2O — CID 123325418
(4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-4-phenylpyrrolidin-2-imine (PubChem CID 123325418) has the molecular formula C21H20F6N2O and a molecular weight of 430.39 g/mol. Its IUPAC name is (4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-4-phenylpyrrolidin-2-imine.
| Compound Name | (4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-4-phenylpyrrolidin-2-imine |
|---|---|
| PubChem CID | 123325418 |
| Molecular Formula | C21H20F6N2O |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-methyl-4-phenylpyrrolidin-2-imine |
| SMILES | [H]/N=C1/C[C@](COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)CN1C |
| InChI | InChI=1S/C21H20F6N2O/c1-29-12-19(10-18(29)28,15-5-3-2-4-6-15)13-30-11-14-7-16(20(22,23)24)9-17(8-14)21(25,26)27/h2-9,28H,10-13H2,1H3/b28-18-/t19-/m0/s1 |
| InChIKey | ZOSCXJBMLXPVEN-UKAWQWHTSA-N |
| XLogP | 5.49 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|