C22H23BF7NO2 — CID 23570746
[4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(4-fluorophenyl)piperidin-1-yl]-methylborinic acid (PubChem CID 23570746) has the molecular formula C22H23BF7NO2 and a molecular weight of 477.23 g/mol. Its IUPAC name is [4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(4-fluorophenyl)piperidin-1-yl]-methylborinic acid.
| Compound Name | [4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(4-fluorophenyl)piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 23570746 |
| Molecular Formula | C22H23BF7NO2 |
| Molecular Weight | 477.23 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(4-fluorophenyl)piperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H23BF7NO2/c1-23(32)31-8-6-20(7-9-31,16-2-4-19(24)5-3-16)14-33-13-15-10-17(21(25,26)27)12-18(11-15)22(28,29)30/h2-5,10-12,32H,6-9,13-14H2,1H3 |
| InChIKey | OULKQHIETYBFHD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.23 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|