C21H23BF4N2O — CID 89298820
CID 89298820 (PubChem CID 89298820) has the molecular formula C21H23BF4N2O and a molecular weight of 406.23 g/mol.
| Compound Name | CID 89298820 |
|---|---|
| PubChem CID | 89298820 |
| Molecular Formula | C21H23BF4N2O |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(F)(F)F)cc(C(C)OCC2(c3ccc(F)cc3)CCN(C)CC2)n1 |
| InChI | InChI=1S/C21H23BF4N2O/c1-14(18-11-16(21(24,25)26)12-19(22)27-18)29-13-20(7-9-28(2)10-8-20)15-3-5-17(23)6-4-15/h3-6,11-12,14H,7-10,13H2,1-2H3 |
| InChIKey | AFTRPDSJCPQJPM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|