C13H23N2O3- — CID 6956411
(2S)-3-methyl-2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]butanoate (PubChem CID 6956411) has the molecular formula C13H23N2O3- and a molecular weight of 255.34 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]butanoate.
| Compound Name | (2S)-3-methyl-2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]butanoate |
|---|---|
| PubChem CID | 6956411 |
| Molecular Formula | C13H23N2O3- |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | (2S)-3-methyl-2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)N[C@H]1CCCC[C@@H]1C)C(=O)[O-] |
| InChI | InChI=1S/C13H24N2O3/c1-8(2)11(12(16)17)15-13(18)14-10-7-5-4-6-9(10)3/h8-11H,4-7H2,1-3H3,(H,16,17)(H2,14,15,18)/p-1/t9-,10-,11-/m0/s1 |
| InChIKey | PSTAOBPFYCVCGO-DCAQKATOSA-M |
| XLogP | 0.64 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |