C20H20N3O2+ — CID 6956712
2-[1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethylidene]indene-1,3-dione (PubChem CID 6956712) has the molecular formula C20H20N3O2+ and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-[1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethylidene]indene-1,3-dione.
| Compound Name | 2-[1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 6956712 |
| Molecular Formula | C20H20N3O2+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethylidene]indene-1,3-dione |
| SMILES | CC(=C1C(=O)c2ccccc2C1=O)N1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C20H19N3O2/c1-14(18-19(24)15-6-2-3-7-16(15)20(18)25)22-10-12-23(13-11-22)17-8-4-5-9-21-17/h2-9H,10-13H2,1H3/p+1 |
| InChIKey | LORLWUYVUNESLV-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 54.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|