C24H25ClN3O3- — CID 6958163
(1S,6S)-6-[[4-[4-(3-chlorophenyl)piperazin-1-yl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 6958163) has the molecular formula C24H25ClN3O3- and a molecular weight of 438.94 g/mol. Its IUPAC name is (1S,6S)-6-[[4-[4-(3-chlorophenyl)piperazin-1-yl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6S)-6-[[4-[4-(3-chlorophenyl)piperazin-1-yl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6958163 |
| Molecular Formula | C24H25ClN3O3- |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (1S,6S)-6-[[4-[4-(3-chlorophenyl)piperazin-1-yl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | O=C([O-])[C@H]1CC=CC[C@@H]1C(=O)Nc1ccc(N2CCN(c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C24H26ClN3O3/c25-17-4-3-5-20(16-17)28-14-12-27(13-15-28)19-10-8-18(9-11-19)26-23(29)21-6-1-2-7-22(21)24(30)31/h1-5,8-11,16,21-22H,6-7,12-15H2,(H,26,29)(H,30,31)/p-1/t21-,22-/m0/s1 |
| InChIKey | RNFJMPQXXDPAJR-VXKWHMMOSA-M |
| XLogP | 2.94 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|