C24H26Cl2N3O3- — CID 6958190
cis-(1R,2S)-2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 6958190) has the molecular formula C24H26Cl2N3O3- and a molecular weight of 475.40 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | cis-(1R,2S)-2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6958190 |
| Molecular Formula | C24H26Cl2N3O3- |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | cis-(1R,2S)-2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | O=C(Nc1ccc(N2CCN(c3cccc(Cl)c3Cl)CC2)cc1)[C@H]1CCCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C24H27Cl2N3O3/c25-20-6-3-7-21(22(20)26)29-14-12-28(13-15-29)17-10-8-16(9-11-17)27-23(30)18-4-1-2-5-19(18)24(31)32/h3,6-11,18-19H,1-2,4-5,12-15H2,(H,27,30)(H,31,32)/p-1/t18-,19+/m0/s1 |
| InChIKey | DTPCNUHGVJIIKP-RBUKOAKNSA-M |
| XLogP | 3.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|