C16H10BrN2O5- — CID 6961723
(E)-2-[(3-bromobenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 6961723) has the molecular formula C16H10BrN2O5- and a molecular weight of 390.17 g/mol. Its IUPAC name is (E)-2-[(3-bromobenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | (E)-2-[(3-bromobenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6961723 |
| Molecular Formula | C16H10BrN2O5- |
| Molecular Weight | 390.17 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | (E)-2-[(3-bromobenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | O=C([O-])/C(=C\c1ccc([N+](=O)[O-])cc1)NC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H11BrN2O5/c17-12-3-1-2-11(9-12)15(20)18-14(16(21)22)8-10-4-6-13(7-5-10)19(23)24/h1-9H,(H,18,20)(H,21,22)/p-1/b14-8+ |
| InChIKey | QDWLPOHQONGJRV-RIYZIHGNSA-M |
| XLogP | 1.88 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|