C19H13BrN4O4S — CID 25424854
3-bromo-N-[(Z)-1-(3-nitrophenyl)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-en-2-yl]benzamide (PubChem CID 25424854) has the molecular formula C19H13BrN4O4S and a molecular weight of 473.31 g/mol. Its IUPAC name is 3-bromo-N-[(Z)-1-(3-nitrophenyl)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-en-2-yl]benzamide.
| Compound Name | 3-bromo-N-[(Z)-1-(3-nitrophenyl)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 25424854 |
| Molecular Formula | C19H13BrN4O4S |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | 3-bromo-N-[(Z)-1-(3-nitrophenyl)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1nccs1)/C(=C/c1cccc([N+](=O)[O-])c1)NC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H13BrN4O4S/c20-14-5-2-4-13(11-14)17(25)22-16(18(26)23-19-21-7-8-29-19)10-12-3-1-6-15(9-12)24(27)28/h1-11H,(H,22,25)(H,21,23,26)/b16-10- |
| InChIKey | NVZJIMINXPNZPW-YBEGLDIGSA-N |
| XLogP | 4.22 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|