C24H28ClNO3 — CID 6962759
cyclopentyl (4R,4aS)-4-(2-chlorophenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 6962759) has the molecular formula C24H28ClNO3 and a molecular weight of 413.95 g/mol. Its IUPAC name is cyclopentyl (4R,4aS)-4-(2-chlorophenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | cyclopentyl (4R,4aS)-4-(2-chlorophenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 6962759 |
| Molecular Formula | C24H28ClNO3 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | cyclopentyl (4R,4aS)-4-(2-chlorophenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCC2)[C@H](c2ccccc2Cl)[C@@H]2C(=O)CC(C)(C)CC2=N1 |
| InChI | InChI=1S/C24H28ClNO3/c1-14-20(23(28)29-15-8-4-5-9-15)21(16-10-6-7-11-17(16)25)22-18(26-14)12-24(2,3)13-19(22)27/h6-7,10-11,15,21-22H,4-5,8-9,12-13H2,1-3H3/t21-,22-/m0/s1 |
| InChIKey | OUXVFHLXOCPRNQ-VXKWHMMOSA-N |
| XLogP | 5.64 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |