C27H30N2O2 — CID 6970655
(4S)-2,7,7-trimethyl-N,4-bis(2-methylphenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 6970655) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (4S)-2,7,7-trimethyl-N,4-bis(2-methylphenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (4S)-2,7,7-trimethyl-N,4-bis(2-methylphenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 6970655 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (4S)-2,7,7-trimethyl-N,4-bis(2-methylphenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2C)[C@H](c2ccccc2C)C2C(=O)CC(C)(C)CC2=N1 |
| InChI | InChI=1S/C27H30N2O2/c1-16-10-6-8-12-19(16)24-23(26(31)29-20-13-9-7-11-17(20)2)18(3)28-21-14-27(4,5)15-22(30)25(21)24/h6-13,24-25H,14-15H2,1-5H3,(H,29,31)/t24-,25?/m0/s1 |
| InChIKey | QDJBWYACYXUAPB-SKCDSABHSA-N |
| XLogP | 5.76 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |