C29H34N2O5 — CID 7910097
(4R)-4-(4-ethoxy-3-methoxyphenyl)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 7910097) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is (4R)-4-(4-ethoxy-3-methoxyphenyl)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (4R)-4-(4-ethoxy-3-methoxyphenyl)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 7910097 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | (4R)-4-(4-ethoxy-3-methoxyphenyl)-N-(2-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CCOc1ccc([C@@H]2C(C(=O)Nc3ccccc3OC)=C(C)N=C3CC(C)(C)CC(=O)C32)cc1OC |
| InChI | InChI=1S/C29H34N2O5/c1-7-36-23-13-12-18(14-24(23)35-6)26-25(28(33)31-19-10-8-9-11-22(19)34-5)17(2)30-20-15-29(3,4)16-21(32)27(20)26/h8-14,26-27H,7,15-16H2,1-6H3,(H,31,33)/t26-,27?/m1/s1 |
| InChIKey | RMESLVYBOVGPDI-AVJYQCBHSA-N |
| XLogP | 5.56 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |