C26H35NO5 — CID 7085979
propan-2-yl (4S)-4-(3-methoxy-4-propoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 7085979) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is propan-2-yl (4S)-4-(3-methoxy-4-propoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | propan-2-yl (4S)-4-(3-methoxy-4-propoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7085979 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | propan-2-yl (4S)-4-(3-methoxy-4-propoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCCOc1ccc([C@H]2C(C(=O)OC(C)C)=C(C)N=C3CC(C)(C)CC(=O)C32)cc1OC |
| InChI | InChI=1S/C26H35NO5/c1-8-11-31-20-10-9-17(12-21(20)30-7)23-22(25(29)32-15(2)3)16(4)27-18-13-26(5,6)14-19(28)24(18)23/h9-10,12,15,23-24H,8,11,13-14H2,1-7H3/t23-,24?/m0/s1 |
| InChIKey | NWBLAHKROAUVFI-UXMRNZNESA-N |
| XLogP | 5.25 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |