C21H26N2O3 — CID 7315077
propyl (4S,4aS)-2,7,7-trimethyl-5-oxo-4-pyridin-4-yl-4,4a,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 7315077) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is propyl (4S,4aS)-2,7,7-trimethyl-5-oxo-4-pyridin-4-yl-4,4a,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | propyl (4S,4aS)-2,7,7-trimethyl-5-oxo-4-pyridin-4-yl-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7315077 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | propyl (4S,4aS)-2,7,7-trimethyl-5-oxo-4-pyridin-4-yl-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCCOC(=O)C1=C(C)N=C2CC(C)(C)CC(=O)[C@H]2[C@H]1c1ccncc1 |
| InChI | InChI=1S/C21H26N2O3/c1-5-10-26-20(25)17-13(2)23-15-11-21(3,4)12-16(24)19(15)18(17)14-6-8-22-9-7-14/h6-9,18-19H,5,10-12H2,1-4H3/t18-,19-/m0/s1 |
| InChIKey | QNHZCBOXVIQPGL-OALUTQOASA-N |
| XLogP | 3.85 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |