C23H29NO3S — CID 11899051
propyl (4R,4aR)-2,7,7-trimethyl-4-(4-methylsulfanylphenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 11899051) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is propyl (4R,4aR)-2,7,7-trimethyl-4-(4-methylsulfanylphenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | propyl (4R,4aR)-2,7,7-trimethyl-4-(4-methylsulfanylphenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 11899051 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | propyl (4R,4aR)-2,7,7-trimethyl-4-(4-methylsulfanylphenyl)-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCCOC(=O)C1=C(C)N=C2CC(C)(C)CC(=O)[C@@H]2[C@@H]1c1ccc(SC)cc1 |
| InChI | InChI=1S/C23H29NO3S/c1-6-11-27-22(26)19-14(2)24-17-12-23(3,4)13-18(25)21(17)20(19)15-7-9-16(28-5)10-8-15/h7-10,20-21H,6,11-13H2,1-5H3/t20-,21-/m1/s1 |
| InChIKey | ZGWHKZUHSGHMJT-NHCUHLMSSA-N |
| XLogP | 5.18 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |