C25H33NO5S — CID 7090201
2-ethylsulfanylethyl (4S)-4-(3-ethoxy-4-hydroxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 7090201) has the molecular formula C25H33NO5S and a molecular weight of 459.61 g/mol. Its IUPAC name is 2-ethylsulfanylethyl (4S)-4-(3-ethoxy-4-hydroxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | 2-ethylsulfanylethyl (4S)-4-(3-ethoxy-4-hydroxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7090201 |
| Molecular Formula | C25H33NO5S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 2-ethylsulfanylethyl (4S)-4-(3-ethoxy-4-hydroxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCOc1cc([C@H]2C(C(=O)OCCSCC)=C(C)N=C3CC(C)(C)CC(=O)C32)ccc1O |
| InChI | InChI=1S/C25H33NO5S/c1-6-30-20-12-16(8-9-18(20)27)22-21(24(29)31-10-11-32-7-2)15(3)26-17-13-25(4,5)14-19(28)23(17)22/h8-9,12,22-23,27H,6-7,10-11,13-14H2,1-5H3/t22-,23?/m0/s1 |
| InChIKey | JTLVWGXRVAZZKT-NQCNTLBGSA-N |
| XLogP | 4.90 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|