C31H37NO7S — CID 7909996
2-ethylsulfanylethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate (PubChem CID 7909996) has the molecular formula C31H37NO7S and a molecular weight of 567.70 g/mol. Its IUPAC name is 2-ethylsulfanylethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate.
| Compound Name | 2-ethylsulfanylethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7909996 |
| Molecular Formula | C31H37NO7S |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 2-ethylsulfanylethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate |
| SMILES | CCOc1cc([C@H]2C(C(=O)OCCSCC)=C(C)N=C3C[C@H](c4ccc(OC)c(OC)c4)CC(=O)C32)ccc1O |
| InChI | InChI=1S/C31H37NO7S/c1-6-38-26-17-20(8-10-23(26)33)29-28(31(35)39-12-13-40-7-2)18(3)32-22-14-21(15-24(34)30(22)29)19-9-11-25(36-4)27(16-19)37-5/h8-11,16-17,21,29-30,33H,6-7,12-15H2,1-5H3/t21-,29-,30?/m0/s1 |
| InChIKey | GSGQVXIBEALATP-KNMHYRPKSA-N |
| XLogP | 5.68 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|