C37H39NO8 — CID 7910053
2-phenylethyl (4S,7R)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate (PubChem CID 7910053) has the molecular formula C37H39NO8 and a molecular weight of 625.72 g/mol. Its IUPAC name is 2-phenylethyl (4S,7R)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate.
| Compound Name | 2-phenylethyl (4S,7R)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7910053 |
| Molecular Formula | C37H39NO8 |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | 2-phenylethyl (4S,7R)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate |
| SMILES | CCOc1cc([C@H]2C(C(=O)OCCc3ccccc3)=C(C)N=C3C[C@@H](c4ccc(OC)c(OC)c4)CC(=O)C32)ccc1OC(C)=O |
| InChI | InChI=1S/C37H39NO8/c1-6-44-33-21-26(13-15-31(33)46-23(3)39)35-34(37(41)45-17-16-24-10-8-7-9-11-24)22(2)38-28-18-27(19-29(40)36(28)35)25-12-14-30(42-4)32(20-25)43-5/h7-15,20-21,27,35-36H,6,16-19H2,1-5H3/t27-,35+,36?/m1/s1 |
| InChIKey | PBZBHFWWAQTFTC-HKVYXKPSSA-N |
| XLogP | 6.39 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|