C30H35NO7 — CID 7910106
ethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(4-ethoxy-3-methoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate (PubChem CID 7910106) has the molecular formula C30H35NO7 and a molecular weight of 521.61 g/mol. Its IUPAC name is ethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(4-ethoxy-3-methoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate.
| Compound Name | ethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(4-ethoxy-3-methoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7910106 |
| Molecular Formula | C30H35NO7 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | ethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(4-ethoxy-3-methoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C2C[C@@H](c3ccc(OC)c(OC)c3)CC(=O)C2[C@@H]1c1ccc(OCC)c(OC)c1 |
| InChI | InChI=1S/C30H35NO7/c1-7-37-24-12-10-19(16-26(24)36-6)28-27(30(33)38-8-2)17(3)31-21-13-20(14-22(32)29(21)28)18-9-11-23(34-4)25(15-18)35-5/h9-12,15-16,20,28-29H,7-8,13-14H2,1-6H3/t20-,28-,29?/m1/s1 |
| InChIKey | RXDRGBOCRQBKCY-CYURYTAKSA-N |
| XLogP | 5.25 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |